A2405512
2-Chloro-3-pyridinecarbonitrile , 98% , 6602-54-6
Synonym(s):
2-Chloronicotinonitrile
CAS NO.:6602-54-6
Empirical Formula: C6H3ClN2
Molecular Weight: 138.55
MDL number: MFCD00014628
EINECS: 229-550-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB123.20 | In Stock |
|
| 250G | RMB315.20 | In Stock |
|
| 500G | RMB403.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-107 °C(lit.) |
| Boiling point: | 112°C 1mm |
| Density | 1.3185 (rough estimate) |
| refractive index | 1.4877 (estimate) |
| Flash point: | 112°C/1mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -2.17±0.10(Predicted) |
| form | Crystalline Powder or Flakes |
| color | White to off-white |
| BRN | 115772 |
| InChI | InChI=1S/C6H3ClN2/c7-6-5(4-8)2-1-3-9-6/h1-3H |
| InChIKey | JAUPUQRPBNDMDT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1C#N |
| CAS DataBase Reference | 6602-54-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-3-cyanopyridine (cas# 6602-54-6) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





