A2407712
2-Chloro-5-nitrobenzotrifluoride , 98% , 777-37-7
Synonym(s):
2-Chloro-5-nitro-α,α,α-trifluorotoluene
CAS NO.:777-37-7
Empirical Formula: C7H3ClF3NO2
Molecular Weight: 225.55
MDL number: MFCD00007296
EINECS: 212-287-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB92.00 | In Stock |
|
| 500G | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22°C |
| Boiling point: | 108 °C/10 mmHg (lit.) |
| Density | 1.527 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| Specific Gravity | 1.527 |
| color | White or Colorless to Yellow |
| FreezingPoint | 20.0 to 23.0 °C |
| FreezingPoint | 20.0 to 23.0 ℃ |
| BRN | 2216169 |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | 1S/C7H3ClF3NO2/c8-6-2-1-4(12(13)14)3-5(6)7(9,10)11/h1-3H |
| InChIKey | HQROXDLWVGFPDE-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)c(c1)C(F)(F)F |
| CAS DataBase Reference | 777-37-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-nitro-2-(trifluoromethyl)-(777-37-7) |
| EPA Substance Registry System | 2-Chloro-5-nitrobenzotrifluoride (777-37-7) |
Description and Uses
2-Chloro-5-nitrobenzotrifluoride is a polysubstituted organic fluorotoluene analogue. Its molecular structure has a reactive group chlorine atom at the 2-position and a nitro group at the 5-position. Therefore, the substance has high chemical reactivity and is widely used in the field of organic synthesis. It can be used to prepare asymmetric and symmetric diamine monomers containing trifluoromethyl groups, which in turn can be used to further prepare soluble polyimide, a multifunctional molecular material[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







