A2408012
(-)-Corey lactone, 4-phenylbenzoate alcohol , ≥98% , 31752-99-5
Synonym(s):
(3aα,4α,5β,6aα)-(−)-Hexahydro-4-(hydroxymethyl)-2-oxo-2H-cyclopenta[b]furan-5-yl 1,1′-biphenyl-4-carboxylate;(3aR,4S,5R,6aS)-Hexahydro-4-hydroxymethyl-5-(4-phenylbenzoyloxy)cyclopenta[b]furan-2-one
CAS NO.:31752-99-5
Empirical Formula: C21H20O5
Molecular Weight: 352.38
MDL number: MFCD00078077
EINECS: 608-667-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB143.20 | In Stock |
|
| 1G | RMB454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-132 °C(lit.) |
| alpha | -89 º (c=1, CHCl3) |
| Boiling point: | 446°C (rough estimate) |
| Density | 1.1818 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| pka | 14.79±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| optical activity | [α]20/D 87°, c = 1 in chloroform |
| Water Solubility | insoluble |
| BRN | 1294692 |
| InChI | 1S/C21H20O5/c22-12-17-16-10-20(23)25-18(16)11-19(17)26-21(24)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,16-19,22H,10-12H2/t16-,17-,18+,19-/m1/s1 |
| InChIKey | SZJVIFMPKWMGSX-UHFFFAOYSA-N |
| SMILES | OC[C@H]1[C@@H](C[C@@H]2OC(=O)C[C@H]12)OC(=O)c3ccc(cc3)-c4ccccc4 |
| CAS DataBase Reference | 31752-99-5(CAS DataBase Reference) |
Description and Uses
(-) Corey lactone phenylbenzoate is a key intermediate in the synthesis of prostaglandins. Versatile building block for prostaglandins. Building block for a potent and selective antiglaucoma agent analog of PGF2α.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |







