A2408812
4-Chloro-3-nitroanisole , 98% , 10298-80-3
Synonym(s):
1-Chloro-4-methoxy-2-nitrobenzene
CAS NO.:10298-80-3
Empirical Formula: C7H6ClNO3
Molecular Weight: 187.58
MDL number: MFCD00007077
EINECS: 233-674-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB283.20 | In Stock |
|
| 500G | RMB1415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-43 °C (lit.) |
| Boiling point: | 293°C |
| Density | 1.366 |
| refractive index | 1.6000 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Amber |
| BRN | 640872 |
| InChI | InChI=1S/C7H6ClNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | HISHUMDTGXICEZ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(OC)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 10298-80-3(CAS DataBase Reference) |
Description and Uses
4-chloro-3-nitroanisole is used to synthesize a group of derivatives of 7-methanesulfonylamino-6-phenoxychromone at the pyrone and phenoxy rings.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BZ8580000 |
| Hazard Note | Irritant |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







![N-[4-[2-(Formylamino)acetyl]-5-hydroxy-2-phenoxyphenylmethanesulfonamide](https://img.chemicalbook.com/CAS/20150408/GIF/149457-03-4.gif)