A2410512
1-Chloro-3-fluorobenzene , 99% , 625-98-9
CAS NO.：625-98-9
Empirical Formula: C6H4ClF
Molecular Weight: 130.55
MDL number: MFCD00000569
EINECS: 210-919-0
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-78 °C |
| Boiling point: | 126-128 °C(lit.) |
| Density | 1.219 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 68 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.219 |
| Water Solubility | Not miscible in water. |
| BRN | 2039303 |
| InChI | InChI=1S/C6H4ClF/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | VZHJIJZEOCBKRA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(F)=C1 |
| CAS DataBase Reference | 625-98-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-3-fluoro-(625-98-9) |
| EPA Substance Registry System | m-Chlorofluorobenzene (625-98-9) |
Description and Uses
1-Chloro-3-fluorobenzene used as medicine and liquid crystal intermediates.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-33-37/39 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | T |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
