A2411012
3-Chloro-2-fluorobenzaldehyde , 97% , 85070-48-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB236.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 214 °C (lit.) |
| Density | 1.35 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 186 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Sensitive | Air Sensitive |
| BRN | 5861249 |
| InChI | InChI=1S/C7H4ClFO/c8-6-3-1-2-5(4-10)7(6)9/h1-4H |
| InChIKey | YAOZCMANASAVFN-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(Cl)=C1F |
| CAS DataBase Reference | 85070-48-0(CAS DataBase Reference) |
Description and Uses
3-Chloro-2-fluorobenzaldehyde is an intermediate used to synthesize small-molecule inhibitors of MDM2-p53 interaction as antitumor agents. It is also used to prepare flavonoid derivatives as selective neuromedin U 2 receptor agonists for obesity treatment.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





