A2411912
(3-Chloro-2-hydroxypropyl)trimethylammonium Chloride , 60wt.%inH2O , 3327-22-8
CAS NO.:3327-22-8
Empirical Formula: C6H15Cl2NO
Molecular Weight: 188.1
MDL number: MFCD00055655
EINECS: 222-048-3
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB28.00 | In Stock |
|
| 100ML | RMB52.00 | In Stock |
|
| 500ML | RMB156.00 | In Stock |
|
| 1L | RMB247.20 | In Stock |
|
| 5L | RMB972.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-193°C |
| Density | 1.154 g/mL at 25 °C |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly), Water (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| PH | 4.8 to 6.4(50g/L, 25℃) |
| Water Solubility | 835.2g/L at 20℃ |
| BRN | 6576172 |
| InChI | InChI=1S/C6H15ClNO.ClH/c1-8(2,3)5-6(9)4-7;/h6,9H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CSPHGSFZFWKVDL-UHFFFAOYSA-M |
| SMILES | [N+](C)(CC(O)CCl)(C)C.[Cl-] |
| LogP | -1.5 at 25℃ |
| CAS DataBase Reference | 3327-22-8(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride (3327-22-8) |
Description and Uses
3-Chloro-2-hydroxypropyltrimethyl ammonium chloride is used in the preparation of multifunctional cationized cotton fabric based on TiO2 nanomaterials.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H351-H412 |
| Precautionary statements | P202-P273-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-52/53-40 |
| Safety Statements | 26-36-61-36/37 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| RTECS | BP5275400 |
| TSCA | TSCA listed |
| HS Code | 2923.90.0100 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 Carc. 2 |
| Toxicity | LDLo subcutaneous in mouse: 500mg/kg |




