A2412812
4-Chloro-2-fluorotoluene , 99% , 452-75-5
CAS NO.：452-75-5
Empirical Formula: C7H6ClF
Molecular Weight: 144.57
MDL number: MFCD00000571
EINECS: 207-210-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB44.00 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB395.20 | In Stock |
|
| 250g | RMB775.20 | In Stock |
|
| 500G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 158 °C/743 mmHg (lit.) |
| Density | 1.186 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 124 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.186 |
| Water Solubility | INSOLUBLE |
| BRN | 1931682 |
| InChI | InChI=1S/C7H6ClF/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | MKFCYQTVSDCXAQ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 452-75-5(CAS DataBase Reference) |
Description and Uses
4-Chloro-2-fluorotoluene has been used in the preparation of 4-chloro-2-fluoro-benzylbromide.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
