A2415712
(-)-B-Chlorodiisopinocampheylborane , 60%inHexane,ca.1.7mol/L , 85116-37-6
Synonym(s):
(−)-B-Chlorodiisopinocampheylborane;(−)-Ipc2BCl
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB84.80 | In Stock |
|
| 100ML | RMB200.80 | In Stock |
|
| 500ML | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-56 °C(lit.) |
| Boiling point: | 66-69°C |
| Density | 0.954 g/mL at 25 °C |
| refractive index | -51 ° (C=neat) |
| Flash point: | 82 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 5937756 |
| InChI | InChI=1S/C20H34BCl/c1-11-15-7-13(19(15,3)4)9-17(11)21(22)18-10-14-8-16(12(18)2)20(14,5)6/h11-18H,7-10H2,1-6H3/t11-,12-,13+,14+,15-,16-,17-,18-/m1/s1 |
| InChIKey | PSEHHVRCDVOTID-VMAIWCPRSA-N |
| SMILES | B(Cl)([C@@H]1C[C@]2([H])C[C@@]([H])(C2(C)C)[C@H]1C)[C@@H]1C[C@]2([H])C[C@@]([H])(C2(C)C)[C@H]1C |
| CAS DataBase Reference | 85116-37-6(CAS DataBase Reference) |
Description and Uses
Both (+)- and (-)-DIP-chloride are used for asymmetric reduction of prochiral ketones and for the preparation of β-amino alcohols.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H314-H336-H410 |
| Precautionary statements | P210-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,F+,N,F |
| Risk Statements | 34-20/22-12-10-67-65-62-51/53-48/20-50/53-11-37 |
| Safety Statements | 9-16-29-33-36/37-61-62-45-36/37/39-26 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 3/8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








