A2415812
2-Chloro-1,3-difluoro-4-nitrobenzene , ≥98%(GC) , 3847-58-3
CAS NO.：3847-58-3
Empirical Formula: C6H2ClF2NO2
Molecular Weight: 193.54
MDL number: MFCD00042201
EINECS: 411-980-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 10g | RMB151.20 | In Stock |
|
| 25G | RMB297.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-43°C |
| Boiling point: | 243.0±35.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C6H2ClF2NO2/c7-5-3(8)1-2-4(6(5)9)10(11)12/h1-2H |
| InChIKey | CTVBVNKEMCGZDF-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C(F)=C1Cl |
| CAS DataBase Reference | 3847-58-3(CAS DataBase Reference) |
Description and Uses
3-Chloro-2,4-difluoronitrobenzene is a pharmaceutical intermediate, which is reported in the literature to be used for the preparation of LSD1 inhibitors and selective HER2 inhibitors.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H314-H317-H410-H318-H400 |
| Precautionary statements | P260-P264-P270-P272-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P391-P405-P501-P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a |
| Hazard Codes | C,N |
| Risk Statements | 20/21/22-50/53-43-34-22 |
| Safety Statements | 36/37/39-45-61-60-28-26-22 |
| RIDADR | 1759 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
