A2416812
4-Chloro-1,2-difluorobenzene , 98% , 696-02-6
CAS NO.:696-02-6
Empirical Formula: C6H3ClF2
Molecular Weight: 148.54
MDL number: MFCD00042572
EINECS: 614-988-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 10G | RMB73.60 | In Stock |
|
| 25G | RMB136.00 | In Stock |
|
| 100G | RMB440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 126 °C (lit.) |
| Density | 1.33 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 96 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 2081081 |
| InChI | InChI=1S/C6H3ClF2/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | OPQMRQYYRSTBME-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 696-02-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Chloro-3,4-difluorobenzene(696-02-6) |
Description and Uses
4-Chloro-1,2-difluorobenzene may be used in the preparation of 1-chloro-4,5-difluoro-2-nitrobenzene.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P301+P312-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,F,Xi,N |
| Risk Statements | 10-22-36/37/38 |
| Safety Statements | 16-26-36-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








