A2419912
9-(Chloromethyl)anthracene , ≥98% , 24463-19-2
CAS NO.:24463-19-2
Empirical Formula: C15H11Cl
Molecular Weight: 226.7
MDL number: MFCD00001263
EINECS: 246-274-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB136.00 | In Stock |
|
| 25G | RMB585.60 | In Stock |
|
| 100g | RMB2029.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C (lit.) |
| Boiling point: | 294.66°C (rough estimate) |
| Density | 1.1510 (rough estimate) |
| refractive index | 1.6281 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | chloroform: soluble |
| form | Powder |
| color | Yellow |
| Water Solubility | Soluble in chloroform. Insoluble in water. |
| Sensitive | Light Sensitive |
| BRN | 1873394 |
| InChI | InChI=1S/C15H11Cl/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H,10H2 |
| InChIKey | PCVRSXXPGXRVEZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2CCl)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 24463-19-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 9-(Chloromethyl)anthracene(24463-19-2) |
Description and Uses
9-(Chloromethyl)anthracene is used as a blocking group reagent used for carboxylic acids, phenols, mercaptans and thiophenols. It is a derivatizing agent for carboxylic acids giving esters with enhanced UV and fluorescence detection in HPLC.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H290-H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P501a-P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | CA9600000 |
| F | 19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LDLo,intravenous,2267ug/kg (2.267mg/kg),Cancer Research. Vol. 36, Pg. 2423, 1976. |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





