A2420012
5-Chloro-1,10-phenanthroline , 98% , 4199-89-7
CAS NO.:4199-89-7
Empirical Formula: C12H7ClN2
Molecular Weight: 214.65
MDL number: MFCD00004980
EINECS: 224-098-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB116.00 | In Stock |
|
| 250MG | RMB120.00 | In Stock |
|
| 1G | RMB282.40 | In Stock |
|
| 5G | RMB969.60 | In Stock |
|
| 25G | RMB4881.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-126 °C (lit.) |
| Boiling point: | 397.4±22.0 °C(Predicted) |
| Density | 1.375±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | It is soluble in organic solvents. |
| form | Crystalline |
| pka | 4.02±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C12H7ClN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H |
| InChIKey | XDUUQOQFSWSZSM-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(Cl)C=C3C=2N=CC=C3)C=CC=1 |
| CAS DataBase Reference | 4199-89-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1,10-Phenanthroline, 5-chloro- (4199-89-7) |
Description and Uses
Used to prepare 1,10-phenanthrolinium cation. It is also used to make other chemicals.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.49.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |








