A2421412
4-Chloro-3-nitroaniline , 99% , 635-22-3
Synonym(s):
4-Amino-1-chloro-2-nitrobenzene
CAS NO.：635-22-3
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00007844
EINECS: 211-231-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-101 °C (lit.) |
| Boiling point: | 200°C (rough estimate) |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5870 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 1.87±0.10(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 1309394 |
| InChI | InChI=1S/C6H5ClN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| InChIKey | FOHHWGVAOVDVLP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Cl)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 635-22-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-chloro-3-nitro-(635-22-3) |
| EPA Substance Registry System | 4-Chloro-3-nitroaniline (635-22-3) |
Description and Uses
Intermediate in the manufacture of azo dyes, pharmaceuticals, and other organic compounds.
Safety
| Symbol(GHS) |     GHS06,GHS08,GHS09,GHS07 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H315-H319-H300-H310-H330-H373-H411 |
| Precautionary statements | P301+P310a-P304+P340-P320-P330-P501a-P260-P264-P273-P280-P284-P302+P350-P262-P270-P271-P301+P310+P330-P302+P352+P310+P361+P364-P304+P340+P310-P305+P351+P338+P337+P313-P314-P391-P403+P233-P405-P501 |
| Hazard Codes | T+,N,T |
| Risk Statements | 26/27/28-33-51/53 |
| Safety Statements | 28-36/37-45-61-28A |
| RIDADR | UN 2237 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX1750000 |
| Hazard Note | Very Toxic |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Hazardous Substances Data | 635-22-3(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
