A2422612
2-Chloro-3-methyl-5-nitropyridine , 99% , 22280-56-4
Synonym(s):
2-Chloro-5-nitro-3-picoline
CAS NO.：22280-56-4
Empirical Formula: C6H5ClN2O2
Molecular Weight: 172.57
MDL number: MFCD00173686
EINECS: 244-889-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB46.40 | In Stock |
|
| 25G | RMB160.80 | In Stock |
|
| 100G | RMB464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-50 °C |
| Boiling point: | 145 °C / 18mmHg |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >110°C |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | -3.61±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light beige to cream |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| InChIKey | OSIOIGXJUZTWRI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1C |
| CAS DataBase Reference | 22280-56-4(CAS DataBase Reference) |
Description and Uses
2-Chloro-3-methyl-5-nitropyridine is a nitropyridine compound, mainly used as an organic synthetic raw material or pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22 |
| Safety Statements | 37/39-26-39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
