A2423012
Copper(II) trifluoroacetate hydrate , 123333-88-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB86.40 | In Stock |
|
| 10G | RMB136.80 | In Stock |
|
| 50G | RMB401.60 | In Stock |
|
| 100G | RMB943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Store at room temperature |
| solubility | Water (Slightly) |
| form | Crystalline |
| Appearance | Light blue to blue Solid |
| InChI | 1S/2C2HF3O2.Cu.H2O/c2*3-2(4,5)1(6)7;;/h2*(H,6,7);;1H2/q;;+2;/p-2 |
| InChIKey | JIDMEYQIXXJQCC-UHFFFAOYSA-L |
| SMILES | O.FC(F)(F)C(=O)O[Cu]OC(=O)C(F)(F)F |
| CAS DataBase Reference | 123333-88-0 |
Description and Uses
As Heterogeneous Catalysts. It is suitable for use as an electrocatalyst in gas diffusion electrodes. As Electrochemical gas sensors. As organic intermediate, as reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29159000 |
| Storage Class | 11 - Combustible Solids |




