A2423912
3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonyl chloride , 97% , 69399-79-7
CAS NO.：69399-79-7
Empirical Formula: C11H6Cl2FNO2
Molecular Weight: 274.08
MDL number: MFCD00055650
EINECS: 273-987-0
| Pack Size | Price | Stock | Quantity |
| 2G | RMB159.20 | In Stock |
|
| 10G | RMB679.20 | In Stock |
|
| 50G | RMB2719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48 °C |
| Boiling point: | 368.3±42.0 °C(Predicted) |
| Density | 1.445±0.06 g/cm3(Predicted) |
| vapor pressure | 0.002Pa at 25℃ |
| storage temp. | 2-8°C |
| pka | -6.74±0.50(Predicted) |
| form | solid |
| color | Faint beige to faint yellow |
| Water Solubility | 68.42mg/L at 25℃ |
| Sensitive | Moisture Sensitive |
| BRN | 6867336 |
| InChI | InChI=1S/C11H6Cl2FNO2/c1-5-8(11(13)16)10(15-17-5)9-6(12)3-2-4-7(9)14/h2-4H,1H3 |
| InChIKey | XJCUKCOLGJDGGN-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1=C(C)ON=C1C1=C(F)C=CC=C1Cl)=O |
| LogP | 2.81 at 25℃ |
| CAS DataBase Reference | 69399-79-7(CAS DataBase Reference) |
Description and Uses
3-(2-Chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonyl chloride is used for preparing isoxazolyl penicillin derivatives.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-26/36/37/39/45-20 |
| RIDADR | 3261 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2934999090 |
