A2424112
2-Chloro-2',4'-difluoroacetophenone , 98% , 51336-94-8
CAS NO.：51336-94-8
Empirical Formula: C8H5ClF2O
Molecular Weight: 190.57
MDL number: MFCD00013252
EINECS: 620-343-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB205.60 | In Stock |
|
| 100g | RMB635.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-48 °C(lit.) |
| Boiling point: | 240.9±25.0 °C(Predicted) |
| Density | 1.3544 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly) |
| form | Solid |
| color | Light Brown |
| Sensitive | Lachrymatory |
| BRN | 1943217 |
| InChI | InChI=1S/C8H5ClF2O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2 |
| InChIKey | UENGBOCGGKLVJJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C=C1F)CCl |
| CAS DataBase Reference | 51336-94-8(CAS DataBase Reference) |
Description and Uses
2-Chloro-2′,4′-difluoroacetophenone was used in the synthesis of allyl alcohol.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H314-H317-H330-H410 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45-25-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Irritant/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29147000 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
