A2429712
5-Chloro-2-fluoroaniline , 97% , 2106-05-0
Synonym(s):
5-Chloro-2-fluorophenylamine
CAS NO.:2106-05-0
Empirical Formula: C6H5ClFN
Molecular Weight: 145.56
MDL number: MFCD00069416
EINECS: 218-284-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB157.60 | In Stock |
|
| 100g | RMB395.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 102-105 °C/20 mmHg (lit.) |
| Density | 1.29 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 219 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.15±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H5ClFN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| InChIKey | JCYROOANFKVAIB-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=CC=C1F |
| CAS DataBase Reference | 2106-05-0(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-fluoroaniline is also involved in the synthesis of glucocorticoid receptor agonist for inflammation treatments.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-20/21/22-23/24/25 |
| Safety Statements | 26-36-2636/37/39-23-36/37/39-45 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







