A2431512
4-Chloro-3-fluorophenol , 98% , 348-60-7
CAS NO.：348-60-7
Empirical Formula: C6H4ClFO
Molecular Weight: 146.55
MDL number: MFCD00042583
EINECS: 609-036-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB335.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-56 °C (lit.) |
| Boiling point: | 84 °C/44 mmHg (lit.) |
| Density | 1.3675 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | chloroform: soluble50mg/mL, clear, colorless |
| pka | 8.52±0.18(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow, may discolor to orange during storage |
| BRN | 3236440 |
| InChI | InChI=1S/C6H4ClFO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| InChIKey | XLHYAEBESNFTCA-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Cl)C(F)=C1 |
| CAS DataBase Reference | 348-60-7(CAS DataBase Reference) |
Description and Uses
4-Chloro-3-fluorophenol was used in the synthesis of 4-chloro-3-fluoro catechol and 5-Chloro-4-fluoro-2-hydroxyacetophenone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 8 |
| HS Code | 29081990 |
