PRODUCT Properties
| Melting point: | 28-32 °C |
| Boiling point: | 263°C(lit.) |
| Density | 1.2108 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | Solid |
| pka | 3.88±0.12(Predicted) |
| color | Off-White to Yellow |
| λmax | 317nm(EtOH aq.)(lit.) |
| BRN | 114722 |
| InChI | InChI=1S/C9H6ClN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| InChIKey | HJSRGOVAIOPERP-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(Cl)C=CC=2)C=CC=1 |
Description and Uses
5-Chloroquinoline (cas# 635-27-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
