PRODUCT Properties
Melting point: | 28-32 °C |
Boiling point: | 263°C(lit.) |
Density | 1.2108 (rough estimate) |
refractive index | 1.6110 (estimate) |
storage temp. | Sealed in dry,2-8°C |
solubility | Chloroform, Ethyl Acetate, Methanol |
form | Solid |
pka | 3.88±0.12(Predicted) |
color | Off-White to Yellow |
λmax | 317nm(EtOH aq.)(lit.) |
BRN | 114722 |
InChI | InChI=1S/C9H6ClN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
InChIKey | HJSRGOVAIOPERP-UHFFFAOYSA-N |
SMILES | N1C2C(=C(Cl)C=CC=2)C=CC=1 |
Description and Uses
5-Chloroquinoline (cas# 635-27-8) is a compound useful in organic synthesis.
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P305+P351+P338 |
Hazard Codes | Xi |
Risk Statements | 36/37/38 |
Safety Statements | 26-36 |
WGK Germany | 3 |
HS Code | 2933998090 |