A2438712
4-Chlorobenzoylacetonitrile , >98.0%(GC) , 4640-66-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100g | RMB864.00 | In Stock |
|
| 500g | RMB4035.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-133 °C(lit.) |
| Boiling point: | 349.3±22.0 °C(Predicted) |
| Density | 1.2364 (rough estimate) |
| refractive index | 1.422-1.424 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Dichloromethane, Ether, Ethyl Acetate and Methanol |
| pka | 7.37±0.10(Predicted) |
| form | Light Yellow Needles |
| color | White to Yellow to Orange |
| BRN | 743368 |
| InChI | InChI=1S/C9H6ClNO/c10-8-3-1-7(2-4-8)9(12)5-6-11/h1-4H,5H2 |
| InChIKey | JYOUFPNYTOFCSJ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(Cl)=CC=1)(=O)CC#N |
| CAS DataBase Reference | 4640-66-8(CAS DataBase Reference) |
Description and Uses
4-Chlorobenzoylacetonitrile (cas# 4640-66-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







