A2439112
4-Cumylphenol , 98% , 599-64-4
Synonym(s):
4-(2-Phenylisopropyl)phenol
CAS NO.:599-64-4
Empirical Formula: C15H16O
Molecular Weight: 212.29
MDL number: MFCD00002365
EINECS: 209-968-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB52.80 | In Stock |
|
| 100G | RMB129.60 | In Stock |
|
| 500G | RMB388.80 | In Stock |
|
| 2.5KG | RMB1746.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-76 °C (lit.) |
| Boiling point: | 335 °C (lit.) |
| Density | 1,115 g/cm3 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5725 (estimate) |
| Flash point: | 160 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.62±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 18mg/L at 22℃ |
| BRN | 1870517 |
| Stability: | Stable. Incompatible with oxidizing agents, acid chlorides, acid anhydrides. Combustible. |
| InChI | 1S/C15H16O/c1-15(2,12-6-4-3-5-7-12)13-8-10-14(16)11-9-13/h3-11,16H,1-2H3 |
| InChIKey | QBDSZLJBMIMQRS-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c2ccc(O)cc2 |
| LogP | 3.8 at 22℃ |
| CAS DataBase Reference | 599-64-4(CAS DataBase Reference) |
| NIST Chemistry Reference | p-«alpha»-Cumylphenol(599-64-4) |
| EPA Substance Registry System | p-Cumylphenol (599-64-4) |
Description and Uses
Surfactants, Phenolic Resins, Polycarbonate Chain Terminator
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| RTECS | SL1942450 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 599-64-4(Hazardous Substances Data) |





![2,2-Bis[3,5-dibromo-4-(2,3-dibromopropoxy)phenyl]propane](https://img.chemicalbook.com/CAS/GIF/21850-44-2.gif)
![2,2-Bis[4-(4-aminophenoxyphenyl])hexafluoropropane](https://img.chemicalbook.com/CAS/20180906/GIF/479545-03-4.gif)