A2441312
2-Chloro-4-fluorobenzyl bromide , >98.0%(GC) , 45767-66-6
CAS NO.:45767-66-6
Empirical Formula: C7H5BrClF
Molecular Weight: 223.47
MDL number: MFCD00236025
EINECS: 207-274-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100G | RMB639.20 | In Stock |
|
| 500g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33-35°C |
| Boiling point: | 226.8±25.0 °C(Predicted) |
| Density | 1.3879 (rough estimate) |
| refractive index | 1.5550 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Low Melting Mass |
| color | White to yellow |
| Sensitive | Lachrymatory |
| BRN | 3539265 |
| InChI | InChI=1S/C7H5BrClF/c8-4-5-1-2-6(10)3-7(5)9/h1-3H,4H2 |
| InChIKey | GAUUDQVOPUKGJD-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 45767-66-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-fluorobenzyl bromide is used as a reagent in the synthesis of a variety of compounds, such as pharmaceuticals, agrochemicals, and industrial chemicals.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314-H318 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P305+P351+P338-P309-P310 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-22 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | 3265 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





