A2442212
2-Chloro-1-fluoro-4-nitrobenzene , ≥98.0% , 350-30-1
Synonym(s):
2-Chloro-1-fluoro-4-nitrobenzene
CAS NO.:350-30-1
Empirical Formula: C6H3ClFNO2
Molecular Weight: 175.54
MDL number: MFCD00007206
EINECS: 206-499-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB90.40 | In Stock |
|
| 500G | RMB307.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 °C(lit.) |
| Boiling point: | 227-232°C |
| Density | 1.61 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1944997 |
| InChI | InChI=1S/C6H3ClFNO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H |
| InChIKey | DPHCXXYPSYMICK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 350-30-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Chloro-4-fluoronitrobenzene(350-30-1) |
| EPA Substance Registry System | 3-Chloro-4-fluoronitrobenzene (350-30-1) |
Description and Uses
2-Chloro-1-fluoro-4-nitrobenzene has been used in synthesis of:
- benzoimidolones on Ameba resin
- methyl 6,7,8,9-tetrahydropyrido[1,2-a]indol-10-ylacetate
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-39-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CZ0720000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







![Benzonitrile, 5-methoxy-4-[3-(4-morpholinyl)propoxy]-2-nitro-](https://img.chemicalbook.com/CAS/20200611/GIF/385784-71-4.gif)