A2442512
5-Chloro-2-nitrotoluene , ≥98.0% , 5367-28-2
CAS NO.:5367-28-2
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00024579
EINECS: 226-355-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB78.40 | In Stock |
|
| 100g | RMB239.20 | In Stock |
|
| 500g | RMB680.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-30 °C (lit.) |
| Boiling point: | 124-126 °C (16 mmHg) |
| Density | 1.32 |
| refractive index | 1.57-1.572 |
| Flash point: | 202 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump |
| color | White to Light yellow |
| Water Solubility | insoluble |
| InChI | 1S/C7H6ClNO2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | NSMZCUAVEOTJDS-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1[N+]([O-])=O |
| CAS DataBase Reference | 5367-28-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-nitrotoluene(5367-28-2) |
Description and Uses
The cytotoxicity of 5-chloro-2-nitrotoluene, an analog of chlorphenamidine, was studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-36/37/38-20/21/22-52/53 |
| Safety Statements | 26-36-36/37/39-61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XS9134000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |



