A2445112
4-Chloro-2-methylbenzoic acid , >98.0%(GC) , 7499-07-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB49.60 | In Stock |
|
| 25G | RMB186.40 | In Stock |
|
| 100g | RMB239.20 | In Stock |
|
| 500g | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-171 °C (lit.) |
| Boiling point: | 300.3±22.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.63±0.25(Predicted) |
| color | White |
| InChI | InChI=1S/C8H7ClO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | XXFKOBGFMUIWDH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C=C1C |
| CAS DataBase Reference | 7499-07-2(CAS DataBase Reference) |
Description and Uses
4-Chloro-2-methylbenzoic acid can be used in the synthesis of:
- 4-chloro-2-methylbenzophenone via Freidel Craft′s acylation with benzene
- 4-chloro-2-methyl-5-(methylsulfonyl)benzoic acid
- 4-chloro-2-methyl-3-nitrobenzoic acid methyl ester
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
