A2445712
Carbonyl-2,4-pentanedionato(triphenylphosphine)rhodium(I) , Rh21% , 25470-96-6
CAS NO.:25470-96-6
Empirical Formula: C24H22O3PRh
Molecular Weight: 492.31
MDL number: MFCD00064611
EINECS: 247-015-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB572.00 | In Stock |
|
| 1G | RMB2079.20 | In Stock |
|
| 5G | RMB10159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-204°C |
| Density | 1.5[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| solubility | Soluble in acetone and chlorinated solvents |
| form | solid |
| color | yellow |
| Water Solubility | 24μg/L at 20℃ |
| Merck | 14,356 |
| Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 1 mg/m3 NIOSH: IDLH 2 mg/m3; IDLH 100 mg/m3; TWA 0.001 mg/m3; TWA 0.1 mg/m3 |
| InChI | InChI=1S/C18H15P.C5H7O2.CO.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(6)3-5(2)7;1-2;/h1-15H;3H,1-2H3;;/q;-1;;/p+1 |
| InChIKey | ZETXURAVPSJSPU-UHFFFAOYSA-O |
| SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)[Rh+]1(O=C(C)[CH-]C(C)=O1)C#O |
| EPA Substance Registry System | Rhodium, carbonyl(2,4-pentanedionato-.kappa.O,.kappa.O')(triphenylphosphine)-, (SP-4-2)- (25470-96-6) |
Description and Uses
Hydroformylation
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319-H413 |
| Precautionary statements | P301+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |




