A2450812
2-Chloro-4-(trifluoromethyl)pyridine , 98% , 81565-18-6
CAS NO.:81565-18-6
Empirical Formula: C6H3ClF3N
Molecular Weight: 181.54
MDL number: MFCD00042224
EINECS: 617-242-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25g | RMB319.20 | In Stock |
|
| 100g | RMB1223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -19°C |
| Boiling point: | 146-147 °C(lit.) |
| Density | 1.411 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 127 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Sparingly) |
| pka | -1.34±0.10(Predicted) |
| form | Oil |
| color | Colourless |
| BRN | 4246276 |
| InChI | InChI=1S/C6H3ClF3N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H |
| InChIKey | GBNPVXZNWBWNEN-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 81565-18-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-4-(trifluoromethyl)pyridine may be used in the synthesis of:
- 4,4′-bis( trifluoromethyl)-2,2′-bipyridine
- 4-(trifluoromethyl)pyridine
- 1,3-bis(4-(trifluoromethyl)pyridin-2-yl)benzene
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T,F |
| Risk Statements | 10-36/37/38-25-11 |
| Safety Statements | 26-36-45-36/37/39-22-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






