A2451512
2-Chloro-4-fluorobenzylamine , 97% , 15205-11-5
CAS NO.:15205-11-5
Empirical Formula: C7H7ClFN
Molecular Weight: 159.59
MDL number: MFCD00042532
EINECS: 670-919-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB34.40 | In Stock |
|
| 5G | RMB112.00 | In Stock |
|
| 25G | RMB355.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-173 °C(Solv: N,N-dimethylformamide (68-12-2)) |
| Boiling point: | 94 °C |
| Density | 1.270±0.06 g/cm3(Predicted) |
| refractive index | 1.535 |
| Flash point: | >110°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 8.46±0.10(Predicted) |
| form | liquid |
| color | Clear, colourless |
| Sensitive | Air Sensitive |
| BRN | 2936421 |
| InChI | InChI=1S/C7H7ClFN/c8-7-3-6(9)2-1-5(7)4-10/h1-3H,4,10H2 |
| InChIKey | CBKWAXKMZUULLO-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 15205-11-5(CAS DataBase Reference) |
Description and Uses
2-chloro-4-fluorobenzylamine is employed to react with 1-(2-nitrophenyl)pyrrole derivatives to synthesize the corresponding pyrrolo[1,2-a]quinoxaline derivatives.1
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2735 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2921490090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







