A2452112
2-Chloro-4-fluoroaniline , ≥98.0% , 2106-02-7
CAS NO.:2106-02-7
Empirical Formula: C6H5ClFN
Molecular Weight: 145.56
MDL number: MFCD00042530
EINECS: 218-282-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB361.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 192 °C (lit.) |
| Density | 1.219 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 209 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.71±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.3111.219 |
| BRN | 2802559 |
| InChI | InChI=1S/C6H5ClFN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | XRAKCYJTJGTSMM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 2106-02-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 2-chloro-4-fluoro- (2106-02-7) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS06,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H311-H332-H373-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280h-P301+P312-P302+P352-P314-P501a |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36-24/25 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







