A2460712
Cilengitide , ≥98% , 188968-51-6
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB633.60 | In Stock |
|
| 10MG | RMB971.20 | In Stock |
|
| 50MG | RMB4091.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | ≥29.43 mg/mL in DMSO; ≥22.56 mg/mL in H2O |
| form | powder |
| pka | 4.01±0.10(Predicted) |
| color | white to beige |
| Water Solubility | Soluble to 10 mg/ml in water |
| InChIKey | AMLYAMJWYAIXIA-MAVOJUFWNA-N |
| SMILES | N1(C)[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](CC2C=CC=CC=2)C1=O |&1:2,9,24,32,r| |
Description and Uses
Angiogenesis inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






