A2463712
5-Chloronicotinic Acid , 95% , 22620-27-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB230.40 | In Stock |
|
| 25G | RMB953.60 | In Stock |
|
| 100g | RMB2927.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-171°C |
| Boiling point: | 303.7±22.0 °C(Predicted) |
| Density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 3.10±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H4ClNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10) |
| InChIKey | XYLPLVUYPAPCML-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Cl)C=C1C(O)=O |
| CAS DataBase Reference | 22620-27-5(CAS DataBase Reference) |
Description and Uses
5-Chloronicotinic Acid is used as reagent/reactant luminescence and hydrothermal preparation of cobalt/cadmium/lead chloronicotinate phenanthroline MOF.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
