PRODUCT Properties
| Melting point: | 236-239°C (dec.) |
| Boiling point: | 525.4±50.0 °C(Predicted) |
| Density | 2.830±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 3.48±0.10(Predicted) |
| form | Solid |
| color | White to Light Brown |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C13H6I4O4/c14-7-3-6(4-8(15)11(7)18)21-12-9(16)1-5(13(19)20)2-10(12)17/h1-4,18H,(H,19,20) |
| InChIKey | HKJUOMPYMPXLFS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1 |
Description and Uses
3,3'',5,5''-Tetraiodo Thyroformic Acid (Levothyroxine EP Impurity H; T4-Benzoic Acid (USP)) is a thyroid hormone analogue and a potent Thyroxine impurity.





