A2468312
Carboxypeptidase B from porcine pancreas(PMSF Treated) , ≥70units/mgprotein , 9025-24-5
Synonym(s):
Peptidyl-L -lysine(L -arginine) hydrolase;Protaminase
CAS NO.:9025-24-5
Empirical Formula: C31H38N4O7S
Molecular Weight: 610.721
MDL number: MFCD00081476
EINECS: 232-788-9
| Pack Size | Price | Stock | Quantity |
| 1KU | RMB679.20 | In Stock |
|
| 5KU | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| form | powder |
| color | white |
| biological source | Porcine pancreas |
| Water Solubility | water: 1mg/mL |
| Specific Activity | 50-55units/mg protein carboxypeptidase B |
| InChIKey | TWURVFFNODFJBJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCC(NC(C)C(NC(C)C(N1CCCC1C(=O)NC(CC1=CC=CC=C1)C(SCC1=CC=CC=C1)=O)=O)=O)=O |
Description and Uses
Carboxypeptidase B from Sigma has been used as a reference for assaying carboxypeptidase activity in lysed pituitary granules derived from the anterior and intermediate lobes of rat. The enzyme has also been used to digest plasma samples by removing C-terminal basic amino acids, to get a distinct band for each allotype during C4 electrophoresis.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H334-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,B,Xn |
| Risk Statements | 36-42-36/37/38 |
| Safety Statements | 26-36-36/37-24-22 |
| WGK Germany | 3 |





