A2473812
Carbimazole , ≥98% , 22232-54-8
Synonym(s):
Carbimazole;Carbimazol;Ethyl 3-methyl-2-thioimidazoline-1-carboxylate;1-Ethoxycarbonyl-3-methyl-2-thio-4-imidazoline;1-Methyl-3-carbethoxy-2-thioglyoxalone
CAS NO.:22232-54-8
Empirical Formula: C7H10N2O2S
Molecular Weight: 186.23
MDL number: MFCD00027421
EINECS: 244-854-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB104.00 | In Stock |
|
| 5G | RMB166.40 | In Stock |
|
| 25G | RMB520.00 | In Stock |
|
| 100G | RMB1804.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124°C |
| Boiling point: | 240.4±23.0 °C(Predicted) |
| Density | 1.2900 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: soluble5mg/mL, clear (warmed) |
| form | powder |
| pka | -1.70±0.20(Predicted) |
| color | white to beige |
| Water Solubility | Soluble in water, ethanol, chloroform and acetone. Sightly soluble in water. |
| Sensitive | Light Sensitive |
| Merck | 14,1798 |
| BRN | 144339 |
| InChI | 1S/C7H10N2O2S/c1-3-11-7(10)9-5-4-8(2)6(9)12/h4-5H,3H2,1-2H3 |
| InChIKey | CFOYWRHIYXMDOT-UHFFFAOYSA-N |
| SMILES | S=[c]1[n](cc[n]1C(=O)OCC)C |
| CAS DataBase Reference | 22232-54-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbimazole(22232-54-8) |
Description and Uses
Ethyl 3-methyl-2-thionoimidazoline-1-carboxylate is used as thyroid inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P261-P280a-P301+P312a-P305+P351+P338-P321-P501a |
| Risk Statements | 22-36-43 |
| Safety Statements | 22-36/37/39 |
| RIDADR | 3335 |
| WGK Germany | 3 |
| RTECS | NJ2441000 |
| HS Code | 2933.29.9000 |
| Storage Class | 11 - Combustible Solids |



