A2476512
                    Clindamycin Phosphate , ≥96% , 24729-96-2
                            Synonym(s):
Clindamycin 2-dihydrogen phosphate;Clindamycin 2-phosphate
                            
                        
                CAS NO.:24729-96-2
Empirical Formula: C18H34ClN2O8PS
Molecular Weight: 504.96
MDL number: MFCD11982855
EINECS: 246-433-0
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB169.60 | In Stock | 
                                                 | 
                                        
| 25G | RMB478.40 | In Stock | 
                                                 | 
                                        
| 100G | RMB1280.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 114 °C | 
                                    
| Boiling point: | 159°C | 
                                    
| Density | 1.41±0.1 g/cm3(Predicted) | 
                                    
| refractive index | 122 ° (C=1, H2O) | 
                                    
| storage temp. | Sealed in dry,2-8°C | 
                                    
| solubility | DMSO: soluble224mg/mL at 25°C | 
                                    
| form | solid | 
                                    
| pka | pKa 0.964±0.06
(H2O t=21) (Uncertain);6.06 ±0.06 (I=0.008)(H2O t=21) (Uncertain) | 
                                    
| color | White | 
                                    
| Water Solubility | Freely soluble in water | 
                                    
| Merck | 14,2356 | 
                                    
| Stability: | Stable, but store cool. Incompatible with strong oxidizing agents, calcium gluconate, barbiturates, magnesium sulfate, phenytoin, B group sodium vitamins. | 
                                    
| InChIKey | UFUVLHLTWXBHGZ-YFBDLMQENA-N | 
                                    
| SMILES | [C@]([H])([C@]1([H])[C@@H]([C@H](O)[C@@H](OP(O)(O)=O)[C@@H](SC)O1)O)([C@@H](Cl)C)NC([C@H]1N(C[C@H](CCC)C1)C)=O |&1:0,2,4,5,7,13,18,23,26,r| | 
                                    
Description and Uses
Clindamycin 2-phosphate is a a salt of clincamycin, a semi-synthetic lincosamide. The salt is prepared by selective phosphorylation of the 2-hydroxy moiety of the sugar of clindamycin. The introduction of the phosphate affords improved solubility for injectable formulations. Like other members of the lincosamide family, clindamycin 2-phosphate is a broad spectrum antibiotic with activity against anaerobic bacteria and protozoans. Clindamycin acts by binding to the 23S ribosomal subunit, blocking protein synthesis.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H317-H319-H362 | 
| Precautionary statements | P260-P263-P280-P301+P312-P302+P352-P308+P313 | 
| Hazard Codes | Xn,Xi | 
| Risk Statements | 22-36/37/38 | 
| Safety Statements | 36-26 | 
| WGK Germany | 3 | 
| RTECS | GF2625000 | 
| HS Code | 29419000 | 




