A2477112
Cholesteryl chloride , >95.0%(HPLC) , 910-31-6
Synonym(s):
3β-Chloro-5-cholestene;Cholesteryl chloride
CAS NO.:910-31-6
Empirical Formula: C27H45Cl
Molecular Weight: 405.1
MDL number: MFCD00003632
EINECS: 213-004-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5g | RMB143.20 | In Stock |
|
| 25G | RMB378.40 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| 500G | RMB4071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| alpha | -30 º (c=1, chloroform) |
| Boiling point: | 488.29°C (rough estimate) |
| Density | 0.9160 (rough estimate) |
| refractive index | 1.6281 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder |
| optical activity | [α]25/D 24°, c = 1 in chloroform |
| BRN | 2703655 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | OTVRYZXVVMZHHW-DPAQBDIFSA-N |
| SMILES | [C@@]12([H])CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](Cl)CC3=CC[C@@]21[H] |&1:0,4,5,13,17,19,23,29,r| |
| LogP | 11.576 (est) |
| CAS DataBase Reference | 910-31-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Cholest-5-ene, 3beta-chloro(910-31-6) |
| EPA Substance Registry System | Cholest-5-ene, 3-chloro-, (3.beta.)- (910-31-6) |
Description and Uses
Cholesteryl chloride is an organochloride derivative of Cholesterol (HY-N0322). Cholesteryl chloride can be used in some hair colors, make-ups, and some other cosmetic preparations[1].
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29035990 |
| Storage Class | 11 - Combustible Solids |



