A2478212
1-Chloro-3-(trifluoromethoxy)benzene , 98% , 772-49-6
CAS NO.：772-49-6
Empirical Formula: C7H4ClF3O
Molecular Weight: 196.55
MDL number: MFCD00276971
EINECS: 231-788-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB235.20 | In Stock |
|
| 100G | RMB779.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 44-46°C 15mm |
| Density | 1.37 |
| refractive index | 1.4360 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| Appearance | Light yellow to yellow Liquid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H4ClF3O/c8-5-2-1-3-6(4-5)12-7(9,10)11/h1-4H |
| InChIKey | OLDJEKBXICPMAS-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 772-49-6(CAS DataBase Reference) |
Description and Uses
1-Chloro-3-(trifluoromethoxy)benzene is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29039990 |
