A2482412
5(6)-Carboxy-2’,7’-dichlorofluorescein 3’,6’-Diacetate , ≥85%, used for fluorescence analysis , 127770-45-0
CAS NO.：127770-45-0
Empirical Formula: C25H14Cl2O9
Molecular Weight: 529.28
MDL number: MFCD00037454
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB861.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.)(lit.) |
| storage temp. | −20°C |
| solubility | DMF: soluble |
| form | A solid |
| color | Off-white to light yellow |
| BRN | 7505106 |
| InChIKey | LZMPJBOMBCYYMP-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc2Oc3cc(OC(C)=O)c(Cl)cc3C4(OC(=O)c5cc(ccc45)C(O)=O)c2cc1Cl.CC(=O)Oc6cc7Oc8cc(OC(C)=O)c(Cl)cc8C9(OC(=O)c%10ccc(cc9%10)C(O)=O)c7cc6Cl |
Description and Uses
5(6)-Carboxy-2’,7’-dichlorofluorescein 3’,6’-Diacetate is a substituted dichlorofluorescein compound. It is used as a fluorescent dye for identification of proteins, nucleuic acids and other species with emissive chelating label.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 8-10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
