A2486612
1-(4-Chlorophenyl)-4，4，4-trifluoro-1，3-butanedione , 97% , 18931-60-7
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB44.00 | In Stock |
|
| 1G | RMB128.80 | In Stock |
|
| 5G | RMB403.20 | In Stock |
|
| 25g | RMB1236.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-64 °C (lit.) |
| Boiling point: | 292.4±35.0 °C(Predicted) |
| Density | 1.396±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.35±0.25(Predicted) |
| color | White to Almost white |
| InChI | 1S/C10H6ClF3O2/c11-7-3-1-6(2-4-7)8(15)5-9(16)10(12,13)14/h1-4H,5H2 |
| InChIKey | LJHFYVKVIIMXQM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)CC(=O)c1ccc(Cl)cc1 |
| CAS DataBase Reference | 18931-60-7(CAS DataBase Reference) |
Description and Uses
1-(4-Chlorophenyl)-4,4,4-trifluoro-1,3-butanedione is used in the synthesis of anti-inflammatory agents and cyclooxygenase inhibitors as apoptosis-inducing agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
