A2487812
4-Chloro-3-nitrobenzaldehyde , 98% , 16588-34-4
CAS NO.：16588-34-4
Empirical Formula: C7H4ClNO3
Molecular Weight: 185.56
MDL number: MFCD00007078
EINECS: 240-645-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB759.20 | In Stock |
|
| 250G | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-63 °C (lit.) |
| Boiling point: | 276.5°C (rough estimate) |
| Density | 1.4791 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 4g/l |
| form | Powder |
| color | Off-white to light yellow to light green |
| Water Solubility | 4 g/L (98 ºC) |
| Sensitive | Air Sensitive |
| BRN | 778323 |
| InChI | 1S/C7H4ClNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-4H |
| InChIKey | HETBKLHJEWXWBM-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(C=O)ccc1Cl |
| CAS DataBase Reference | 16588-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-3-nitrobenzaldehyde(16588-34-4) |
| EPA Substance Registry System | Benzaldehyde, 4-chloro-3-nitro- (16588-34-4) |
Description and Uses
4-Chloro-3-nitrobenzaldehyde is a potent inhibitor of VCAM-1 expression and a potential drug candidate for autoimmune and allergic inflammatory diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37-36/37/39-22-36 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
