A2488612
2-Cyano-5-methylpyridine , ≥98.0%(GC) , 1620-77-5
CAS NO.：1620-77-5
Empirical Formula: C7H6N2
Molecular Weight: 118.14
MDL number: MFCD06200830
EINECS: 216-589-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB363.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-75°C |
| Boiling point: | 140°C/20mmHg(lit.) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -0.03±0.10(Predicted) |
| form | Solid |
| color | White to Almost white |
| InChI | InChI=1S/C7H6N2/c1-6-2-3-7(4-8)9-5-6/h2-3,5H,1H3 |
| InChIKey | LIEQVZZZYLHNRH-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(C)C=C1 |
| CAS DataBase Reference | 1620-77-5(CAS DataBase Reference) |
Description and Uses
2-Cyano-5-methylpyridine (5-methylpicolinonitrile) is a methylpyridine analogue mainly used as a raw material or intermediate component in organic synthesis. It is used in the synthesis of 5-Methylpicolinaldehyde and its derivatives.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H331-H335-H301-H315-H319 |
| Precautionary statements | P261-P304+P340-P305+P351+P338-P501a-P264-P270-P280-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
