A2492912
4'-Chlorovalerophenone , ≥96.0%(GC) , 25017-08-7
CAS NO.：25017-08-7
Empirical Formula: C11H13ClO
Molecular Weight: 196.67
MDL number: MFCD04038938
EINECS: 246-566-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 10G | RMB78.40 | In Stock |
|
| 50G | RMB479.20 | In Stock |
|
| 250G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-33 °C |
| Boiling point: | 156 °C / 14mmHg |
| Density | 1.0753 (rough estimate) |
| refractive index | 1.5364 (estimate) |
| Flash point: | 30 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | fused solid |
| color | Off-white to faint yellow |
| InChI | InChI=1S/C11H13ClO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
| InChIKey | XMUGWCSIQUJOFA-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(=O)CCCC |
| CAS DataBase Reference | 25017-08-7(CAS DataBase Reference) |
Description and Uses
4-Chlorovalerophenone is often used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| RIDADR | 3077 |
| HS Code | 29420000 |
