A2497012
4-Chlorobutyl acetate , ≥97.0%(GC) , 6962-92-1
CAS NO.：6962-92-1
Empirical Formula: C6H11ClO2
Molecular Weight: 150.6
MDL number: MFCD00001013
EINECS: 230-158-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB88.00 | In Stock |
|
| 100G | RMB243.20 | In Stock |
|
| 500G | RMB976.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 92 °C/22 mmHg (lit.) |
| Density | 1.072 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 148 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Clear Colourless |
| Specific Gravity | 1.08 |
| Water Solubility | inmisceable |
| BRN | 1749681 |
| InChI | InChI=1S/C6H11ClO2/c1-6(8)9-5-3-2-4-7/h2-5H2,1H3 |
| InChIKey | PYLDCZJUHYVOAF-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)CCCCl |
| CAS DataBase Reference | 6962-92-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Butanol, 4-chloro-, acetate(6962-92-1) |
| EPA Substance Registry System | 1-Butanol, 4-chloro-, acetate (6962-92-1) |
Description and Uses
4-Chlorobutyl Acetate is a reagent used in the synthesis of novel cyclic ADP ribose derivatives. Also used in the synthesis of a transient receptor potential melastatin 2 antagonist involved in insulin secretion.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P210e-P280a-P405-P501a-P210-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 3272 |
| WGK Germany | 3 |
| RTECS | EL1328000 |
| TSCA | Yes |
| PackingGroup | III |
| HS Code | 2915907098 |
