A2499012
2-Chloro-1,4-phenylenediamine Sulfate , ≥96.0% , 61702-44-1
Synonym(s):
2-Chloro-1,4-diaminobenzene monosulfate
CAS NO.:61702-44-1
Empirical Formula: C6H9ClN2O4S
Molecular Weight: 240.66
MDL number: MFCD00013004
EINECS: 262-915-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB92.00 | In Stock |
|
| 100G | RMB259.20 | In Stock |
|
| 500G | RMB939.20 | In Stock |
|
| 2.5KG | RMB3359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251-253 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Sparingly), Water (Slightly) |
| form | Solid |
| color | Off-White to Pale Grey |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| BRN | 8441373 |
| Stability: | Stable. Incompatible with oxidizing agents, acids. |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 2-Chloro-1,4-phenylenediamine sulfate (61702-44-1) |
| InChI | 1S/C6H7ClN2.H2O4S/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) |
| InChIKey | GQFGHCRXPLROOF-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.Nc1ccc(N)c(Cl)c1 |
| CAS DataBase Reference | 61702-44-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-1,4-phenylenediamine sulfate (1:1) (61702-44-1) |
Description and Uses
2-Chloro-p-phenylenediamine monosulfate (2-Chloro-1,4-diaminobenzene monosulfate) may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 20/21-36/37/38-33 |
| Safety Statements | 26-36/37/39-39-36-22 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CZ1581000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29215119 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





