A2499112
Cyclopropanecarboxamide , ≥98.0%(GC) , 6228-73-5
CAS NO.：6228-73-5
Empirical Formula: C4H7NO
Molecular Weight: 85.1
MDL number: MFCD00013729
EINECS: 228-332-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 2.5G | RMB24.00 | In Stock |
|
| 5g | RMB28.00 | In Stock |
|
| 10G | RMB36.00 | In Stock |
|
| 25g | RMB52.00 | In Stock |
|
| 50G | RMB79.20 | In Stock |
|
| 100g | RMB135.20 | In Stock |
|
| 250G | RMB287.20 | In Stock |
|
| 500g | RMB436.80 | In Stock |
|
| 2.5kg | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-122°C |
| Boiling point: | 248.5±7.0 °C(Predicted) |
| Density | 1.187±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 16.60±0.20(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| BRN | 1924346 |
| InChI | InChI=1S/C4H7NO/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6) |
| InChIKey | AIMMVWOEOZMVMS-UHFFFAOYSA-N |
| SMILES | C1(C(N)=O)CC1 |
| CAS DataBase Reference | 6228-73-5(CAS DataBase Reference) |
| EPA Substance Registry System | Cyclopropanecarboxamide (6228-73-5) |
Description and Uses
Cyclopropanecarboxamide is used in the preparation of 2-(cyclopropanecarbonyl-amino)-but-2-enoic acid by reacting with 2-oxo-butyric acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 2924297099 |
