A2499712
4-Chloro-2,3-dimethylpyridine N-Oxide , ≥98% , 59886-90-7
CAS NO.：59886-90-7
Empirical Formula: C7H8ClNO
Molecular Weight: 157.6
MDL number: MFCD06411125
EINECS: 611-910-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| 100g | RMB1407.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-105°C |
| Boiling point: | 338.5°C |
| Density | 1.19 |
| vapor pressure | 0.346Pa at 25℃ |
| Flash point: | 158.5°C |
| storage temp. | Room temperature. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.28±0.10(Predicted) |
| color | Pale Yellow to Light Beige |
| InChI | InChI=1S/C7H8ClNO/c1-5-6(2)9(10)4-3-7(5)8/h3-4H,1-2H3 |
| InChIKey | MCUYHRNUDDANSO-UHFFFAOYSA-N |
| SMILES | C1(C)[N+]([O-])=CC=C(Cl)C=1C |
| LogP | 0.4 at 25℃ |
| CAS DataBase Reference | 59886-90-7(CAS DataBase Reference) |
Description and Uses
An intermediate in the synthesis of rabeprazole (R070500).
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341 |
| Precautionary statements | P501-P202-P201-P264-P280-P302+P352-P308+P313-P337+P313-P305+P351+P338-P362+P364-P332+P313-P405 |
| Safety Statements | 24/25 |
| HS Code | 29333990 |
