PRODUCT Properties
| Boiling point: | 86-87°C 9mm |
| Density | 1,076 g/cm3 |
| refractive index | 1.4350 |
| Flash point: | 93°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 4.76±0.10(Predicted) |
| color | Clear Colourless |
| BRN | 2323311 |
| InChI | InChI=1S/C5H8O2/c6-5(7)3-4-1-2-4/h4H,1-3H2,(H,6,7) |
| InChIKey | KVVDRQDTODKIJD-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)CC1 |
| CAS DataBase Reference | 5239-82-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopropaneacetic acid(5239-82-7) |
Description and Uses
Cyclopropylacetic Acid is used in the synthesis of many organic compounds. Such compounds include Cyproconazole which is an agricultural fungicide and also in synthesis of potent nicotinic acid receptor agonists used in treatment of Dyslipidemia.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | C |
| Risk Statements | 34-41-37/38-22 |
| Safety Statements | 26-36/37/39-45-39 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29162000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |




![1H-PYRROLO[2,3-B]PYRIDIN-3-YLACETIC ACID](https://img.chemicalbook.com/CAS/GIF/56105-19-2.gif)


