A2502312
6-Cyano-2-naphthol , 97% , 52927-22-7
Synonym(s):
6-Hydroxy-2-naphthonitrile;2-Cyano-6-hydroxynaphthalene;2-Cyano-6-naphthol;2-Hydroxy-6-naphthonitrile;6-Cyano-2-hydroxynaphthalene
CAS NO.：52927-22-7
Empirical Formula: C11H7NO
Molecular Weight: 169.18
MDL number: MFCD01863480
EINECS: 628-663-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 50g | RMB879.20 | In Stock |
|
| 100G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165.5-170.5 °C (lit.) |
| Boiling point: | 383.1±15.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethanol, Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 8.57±0.40(Predicted) |
| form | Solid |
| color | Pale Brown to Brown |
| InChI | InChI=1S/C11H7NO/c12-7-8-1-2-10-6-11(13)4-3-9(10)5-8/h1-6,13H |
| InChIKey | WKTNIBWKHNIPQR-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(O)C=C2)=CC=C1C#N |
| CAS DataBase Reference | 52927-22-7(CAS DataBase Reference) |
Description and Uses
Intermediate of Nafamostat mesilate (N210000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29269090 |
